C24H28N2O2 — CID 149123686
2-[(3aS,6aR)-5-(2-phenylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-methyliminoethanone (PubChem CID 149123686) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-(2-phenylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-methyliminoethanone.
| Compound Name | 2-[(3aS,6aR)-5-(2-phenylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-methyliminoethanone |
|---|---|
| PubChem CID | 149123686 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[(3aS,6aR)-5-(2-phenylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-methyliminoethanone |
| SMILES | C/N=C(/C(=O)c1ccc(O)cc1)N1C[C@H]2CC(CCc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C24H28N2O2/c1-25-24(23(28)19-9-11-22(27)12-10-19)26-15-20-13-18(14-21(20)16-26)8-7-17-5-3-2-4-6-17/h2-6,9-12,18,20-21,27H,7-8,13-16H2,1H3/b25-24-/t18?,20-,21+ |
| InChIKey | RALUGQXUMAFESU-JZMUIVKISA-N |
| XLogP | 4.19 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|