C23H25ClN2O2 — CID 149124034
N-[(3-chlorophenyl)methyl]spiro[2,3,6,9-tetrahydro-[1,4]dioxino[2,3-g]quinoline-8,1'-cyclohexane]-7-imine (PubChem CID 149124034) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]spiro[2,3,6,9-tetrahydro-[1,4]dioxino[2,3-g]quinoline-8,1'-cyclohexane]-7-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]spiro[2,3,6,9-tetrahydro-[1,4]dioxino[2,3-g]quinoline-8,1'-cyclohexane]-7-imine |
|---|---|
| PubChem CID | 149124034 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]spiro[2,3,6,9-tetrahydro-[1,4]dioxino[2,3-g]quinoline-8,1'-cyclohexane]-7-imine |
| SMILES | Clc1cccc(C/N=C2\Nc3cc4c(cc3CC23CCCCC3)OCCO4)c1 |
| InChI | InChI=1S/C23H25ClN2O2/c24-18-6-4-5-16(11-18)15-25-22-23(7-2-1-3-8-23)14-17-12-20-21(13-19(17)26-22)28-10-9-27-20/h4-6,11-13H,1-3,7-10,14-15H2,(H,25,26) |
| InChIKey | RANOGTKINNJSBM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|