C29H38O5S — CID 149125935
ethyl (1R,2R,4S,13S)-2-(benzenesulfonyloxy)-5,6-dimethyl-14-methylidenetetracyclo[11.2.2.01,11.04,10]heptadec-5-ene-10-carboxylate (PubChem CID 149125935) has the molecular formula C29H38O5S and a molecular weight of 498.69 g/mol. Its IUPAC name is ethyl (1R,2R,4S,13S)-2-(benzenesulfonyloxy)-5,6-dimethyl-14-methylidenetetracyclo[11.2.2.01,11.04,10]heptadec-5-ene-10-carboxylate.
| Compound Name | ethyl (1R,2R,4S,13S)-2-(benzenesulfonyloxy)-5,6-dimethyl-14-methylidenetetracyclo[11.2.2.01,11.04,10]heptadec-5-ene-10-carboxylate |
|---|---|
| PubChem CID | 149125935 |
| Molecular Formula | C29H38O5S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | ethyl (1R,2R,4S,13S)-2-(benzenesulfonyloxy)-5,6-dimethyl-14-methylidenetetracyclo[11.2.2.01,11.04,10]heptadec-5-ene-10-carboxylate |
| SMILES | C=C1C[C@]23CC[C@H]1CC2C1(C(=O)OCC)CCCC(C)=C(C)[C@@H]1C[C@H]3OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H38O5S/c1-5-33-27(30)29-14-9-10-19(2)21(4)24(29)17-26(34-35(31,32)23-11-7-6-8-12-23)28-15-13-22(16-25(28)29)20(3)18-28/h6-8,11-12,22,24-26H,3,5,9-10,13-18H2,1-2,4H3/t22-,24-,25?,26+,28+,29?/m0/s1 |
| InChIKey | RAXATJSDIYLLRV-ABUNHIHQSA-N |
| XLogP | 6.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|