2-hydroxy-1,3-dihydroindene-2-carboxylic acid

C10H10O3 — CID 14913071

IUPAC2-hydroxy-1,3-dihydroindene-2-carboxylic acid
SMILESO=C(O)C1(O)Cc2ccccc2C1
InChIInChI=1S/C10H10O3/c11-9(12)10(13)5-7-3-1-2-4-8(7)6-10/h1-4,13H,5-6H2,(H,11,12)
InChIKeyQXZHLYGZXSVTGM-UHFFFAOYSA-N
MW178.19 g/mol
LogP0.60
Rot. Bonds1

About 2-hydroxy-1,3-dihydroindene-2-carboxylic acid

2-hydroxy-1,3-dihydroindene-2-carboxylic acid (PubChem CID 14913071) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-hydroxy-1,3-dihydroindene-2-carboxylic acid.

Molecular Properties

Compound Name2-hydroxy-1,3-dihydroindene-2-carboxylic acid
PubChem CID14913071
Molecular FormulaC10H10O3
Molecular Weight178.19 g/mol
Exact Mass178.06
IUPAC Name2-hydroxy-1,3-dihydroindene-2-carboxylic acid
SMILESO=C(O)C1(O)Cc2ccccc2C1
InChIInChI=1S/C10H10O3/c11-9(12)10(13)5-7-3-1-2-4-8(7)6-10/h1-4,13H,5-6H2,(H,11,12)
InChIKeyQXZHLYGZXSVTGM-UHFFFAOYSA-N
XLogP0.60
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.19
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-hydroxy-1,3-dihydroindene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-1,3-dihydroindene-2-carboxylic acid?
The IUPAC name of 2-hydroxy-1,3-dihydroindene-2-carboxylic acid (CID 14913071) is 2-hydroxy-1,3-dihydroindene-2-carboxylic acid.
What is the SMILES notation for 2-hydroxy-1,3-dihydroindene-2-carboxylic acid?
The canonical SMILES for 2-hydroxy-1,3-dihydroindene-2-carboxylic acid is O=C(O)C1(O)Cc2ccccc2C1.
What is the InChIKey of 2-hydroxy-1,3-dihydroindene-2-carboxylic acid?
The InChIKey is QXZHLYGZXSVTGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-9(12)10(13)5-7-3-1-2-4-8(7)6-10/h1-4,13H,5-6H2,(H,11,12).
What are the key properties of 2-hydroxy-1,3-dihydroindene-2-carboxylic acid?
2-hydroxy-1,3-dihydroindene-2-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,3-dihydroindene-2-carboxylic acid is sourced from PubChem (CID 14913071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).