C26H27BN6O2 — CID 149131549
4,6-bis(6-methylpyrazin-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine (PubChem CID 149131549) has the molecular formula C26H27BN6O2 and a molecular weight of 466.35 g/mol. Its IUPAC name is 4,6-bis(6-methylpyrazin-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine.
| Compound Name | 4,6-bis(6-methylpyrazin-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 149131549 |
| Molecular Formula | C26H27BN6O2 |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 4,6-bis(6-methylpyrazin-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
| SMILES | Cc1cncc(-c2cc(-c3cncc(C)n3)nc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)n2)n1 |
| InChI | InChI=1S/C26H27BN6O2/c1-16-12-28-14-22(30-16)20-11-21(23-15-29-13-17(2)31-23)33-24(32-20)18-7-9-19(10-8-18)27-34-25(3,4)26(5,6)35-27/h7-15H,1-6H3 |
| InChIKey | RCPBQKWAWNUPAB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|