C13H18O6 — CID 14913185
methyl 3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)propanoate (PubChem CID 14913185) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)propanoate.
| Compound Name | methyl 3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)propanoate |
|---|---|
| PubChem CID | 14913185 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl 3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)propanoate |
| SMILES | C=CCC1(CCC(=O)OC)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C13H18O6/c1-5-7-13(8-6-9(14)17-4)10(15)18-12(2,3)19-11(13)16/h5H,1,6-8H2,2-4H3 |
| InChIKey | AEOFYCMDFQUROA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|