C22H26ClN3O3 — CID 149132307
(2R,4S)-N-[(2S)-1-[(5-chloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpiperidine-2-carboxamide (PubChem CID 149132307) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is (2R,4S)-N-[(2S)-1-[(5-chloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpiperidine-2-carboxamide.
| Compound Name | (2R,4S)-N-[(2S)-1-[(5-chloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 149132307 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2R,4S)-N-[(2S)-1-[(5-chloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpiperidine-2-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@@H](c2ccccc2)CCN1)C(=O)NCc1cc(Cl)ccc1O |
| InChI | InChI=1S/C22H26ClN3O3/c1-14(21(28)25-13-17-11-18(23)7-8-20(17)27)26-22(29)19-12-16(9-10-24-19)15-5-3-2-4-6-15/h2-8,11,14,16,19,24,27H,9-10,12-13H2,1H3,(H,25,28)(H,26,29)/t14-,16-,19+/m0/s1 |
| InChIKey | RCXPMLSRMHVNNF-URLQWDBASA-N |
| XLogP | 2.70 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|