C19H14BrClFN5O2S — CID 149136187
5-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylmethyl]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 149136187) has the molecular formula C19H14BrClFN5O2S and a molecular weight of 510.78 g/mol. Its IUPAC name is 5-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylmethyl]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylmethyl]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 149136187 |
| Molecular Formula | C19H14BrClFN5O2S |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | 5-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylmethyl]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cn1cc(-c2cccc(CS(=O)(=O)c3cnc(Cl)c(Br)c3)c2F)c2c(N)ncnc21 |
| InChI | InChI=1S/C19H14BrClFN5O2S/c1-27-7-13(15-18(23)25-9-26-19(15)27)12-4-2-3-10(16(12)22)8-30(28,29)11-5-14(20)17(21)24-6-11/h2-7,9H,8H2,1H3,(H2,23,25,26) |
| InChIKey | REYJSPXCTBEMTC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|