C44H45O6S2+ — CID 149139161
[3-[2-[3-cyclohexyl-5-(4-methoxycarbonylphenyl)-2-sulfophenyl]cyclohexyl]phenyl]-(3-hydroxyphenyl)-phenylsulfanium (PubChem CID 149139161) has the molecular formula C44H45O6S2+ and a molecular weight of 733.97 g/mol. Its IUPAC name is [3-[2-[3-cyclohexyl-5-(4-methoxycarbonylphenyl)-2-sulfophenyl]cyclohexyl]phenyl]-(3-hydroxyphenyl)-phenylsulfanium.
| Compound Name | [3-[2-[3-cyclohexyl-5-(4-methoxycarbonylphenyl)-2-sulfophenyl]cyclohexyl]phenyl]-(3-hydroxyphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 149139161 |
| Molecular Formula | C44H45O6S2+ |
| Molecular Weight | 733.97 g/mol |
| Exact Mass | 733.27 |
| IUPAC Name | [3-[2-[3-cyclohexyl-5-(4-methoxycarbonylphenyl)-2-sulfophenyl]cyclohexyl]phenyl]-(3-hydroxyphenyl)-phenylsulfanium |
| SMILES | COC(=O)c1ccc(-c2cc(C3CCCCC3)c(S(=O)(=O)O)c(C3CCCCC3c3cccc([S+](c4ccccc4)c4cccc(O)c4)c3)c2)cc1 |
| InChI | InChI=1S/C44H44O6S2/c1-50-44(46)32-24-22-30(23-25-32)34-27-41(31-12-4-2-5-13-31)43(52(47,48)49)42(28-34)40-21-9-8-20-39(40)33-14-10-18-37(26-33)51(36-16-6-3-7-17-36)38-19-11-15-35(45)29-38/h3,6-7,10-11,14-19,22-29,31,39-40H,2,4-5,8-9,12-13,20-21H2,1H3,(H-,45,47,48,49)/p+1 |
| InChIKey | RGTINRHTNZQMPH-UHFFFAOYSA-O |
| XLogP | 10.68 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.97 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|