C24H16Cl4N2O4 — CID 14913960
3-(2,6-dichlorophenyl)-5-[(4R,5R)-3-(2,6-dichlorophenyl)-5-methoxy-4,5-dihydro-1,2-oxazol-4-yl]-5-phenyl-1,4,2-dioxazole (PubChem CID 14913960) has the molecular formula C24H16Cl4N2O4 and a molecular weight of 538.21 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-5-[(4R,5R)-3-(2,6-dichlorophenyl)-5-methoxy-4,5-dihydro-1,2-oxazol-4-yl]-5-phenyl-1,4,2-dioxazole.
| Compound Name | 3-(2,6-dichlorophenyl)-5-[(4R,5R)-3-(2,6-dichlorophenyl)-5-methoxy-4,5-dihydro-1,2-oxazol-4-yl]-5-phenyl-1,4,2-dioxazole |
|---|---|
| PubChem CID | 14913960 |
| Molecular Formula | C24H16Cl4N2O4 |
| Molecular Weight | 538.21 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-5-[(4R,5R)-3-(2,6-dichlorophenyl)-5-methoxy-4,5-dihydro-1,2-oxazol-4-yl]-5-phenyl-1,4,2-dioxazole |
| SMILES | CO[C@@H]1ON=C(c2c(Cl)cccc2Cl)[C@H]1C1(c2ccccc2)ON=C(c2c(Cl)cccc2Cl)O1 |
| InChI | InChI=1S/C24H16Cl4N2O4/c1-31-23-20(21(29-33-23)18-14(25)9-5-10-15(18)26)24(13-7-3-2-4-8-13)32-22(30-34-24)19-16(27)11-6-12-17(19)28/h2-12,20,23H,1H3/t20-,23-,24?/m1/s1 |
| InChIKey | IHIIYMMCZZZGCA-BPUXPJLDSA-N |
| XLogP | 6.88 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.21 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |