C19H26O6 — CID 149139724
[(7R,9aS)-7-[(Z)-but-1-enyl]-7-hydroxy-8-methyl-3-methylidene-2-oxo-3a,4,5,9a-tetrahydrofuro[3,2-d]oxocin-4-yl] 2-methylpropanoate (PubChem CID 149139724) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(7R,9aS)-7-[(Z)-but-1-enyl]-7-hydroxy-8-methyl-3-methylidene-2-oxo-3a,4,5,9a-tetrahydrofuro[3,2-d]oxocin-4-yl] 2-methylpropanoate.
| Compound Name | [(7R,9aS)-7-[(Z)-but-1-enyl]-7-hydroxy-8-methyl-3-methylidene-2-oxo-3a,4,5,9a-tetrahydrofuro[3,2-d]oxocin-4-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 149139724 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(7R,9aS)-7-[(Z)-but-1-enyl]-7-hydroxy-8-methyl-3-methylidene-2-oxo-3a,4,5,9a-tetrahydrofuro[3,2-d]oxocin-4-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@H]2C=C(C)[C@@](O)(/C=C\CC)OCC(OC(=O)C(C)C)C12 |
| InChI | InChI=1S/C19H26O6/c1-6-7-8-19(22)12(4)9-14-16(13(5)18(21)24-14)15(10-23-19)25-17(20)11(2)3/h7-9,11,14-16,22H,5-6,10H2,1-4H3/b8-7-,12-9?/t14-,15?,16?,19+/m0/s1 |
| InChIKey | RHMYATNABGWLMA-WUXZQDKMSA-N |
| XLogP | 2.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|