C20H19FN4O4S — CID 149141449
3-[[6-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-1,3-benzothiazol-2-yl]amino]-2,2-dimethylpropanoic acid (PubChem CID 149141449) has the molecular formula C20H19FN4O4S and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-[[6-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-1,3-benzothiazol-2-yl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[6-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-1,3-benzothiazol-2-yl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 149141449 |
| Molecular Formula | C20H19FN4O4S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-[[6-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-1,3-benzothiazol-2-yl]amino]-2,2-dimethylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc3nc(NCC(C)(C)C(=O)O)sc3c2)c(F)c1 |
| InChI | InChI=1S/C20H19FN4O4S/c1-20(2,18(27)28)9-24-19-25-13-5-3-11(8-15(13)30-19)17(26)29-14-6-4-10(16(22)23)7-12(14)21/h3-8H,9H2,1-2H3,(H3,22,23)(H,24,25)(H,27,28) |
| InChIKey | RHVPYLWOKAXTGG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|