C15H17F13OSi — CID 14914234
trimethyl-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane (PubChem CID 14914234) has the molecular formula C15H17F13OSi and a molecular weight of 488.36 g/mol. Its IUPAC name is trimethyl-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane.
| Compound Name | trimethyl-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 14914234 |
| Molecular Formula | C15H17F13OSi |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | trimethyl-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane |
| SMILES | C[Si](C)(C)OC1=CCCCC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H17F13OSi/c1-30(2,3)29-9-7-5-4-6-8(9)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h7-8H,4-6H2,1-3H3 |
| InChIKey | POGKMEJQUXEXPT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|