C21H29F13OSi — CID 14914239
tri(propan-2-yl)-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane (PubChem CID 14914239) has the molecular formula C21H29F13OSi and a molecular weight of 572.52 g/mol. Its IUPAC name is tri(propan-2-yl)-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 14914239 |
| Molecular Formula | C21H29F13OSi |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | tri(propan-2-yl)-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexen-1-yl]oxysilane |
| SMILES | CC(C)[Si](OC1=CCCCC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H29F13OSi/c1-11(2)36(12(3)4,13(5)6)35-15-10-8-7-9-14(15)16(22,23)17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)34/h10-14H,7-9H2,1-6H3 |
| InChIKey | CXHZNUJORHWFRU-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|