C18H29F7OSi — CID 14914241
[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 14914241) has the molecular formula C18H29F7OSi and a molecular weight of 422.50 g/mol. Its IUPAC name is [6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 14914241 |
| Molecular Formula | C18H29F7OSi |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1=CCCCC1C(F)(C(F)(F)F)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29F7OSi/c1-11(2)27(12(3)4,13(5)6)26-15-10-8-7-9-14(15)16(19,17(20,21)22)18(23,24)25/h10-14H,7-9H2,1-6H3 |
| InChIKey | PKMKPAPBIMSSMN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|