C13H21F7OSi — CID 14914247
[(E)-5-ethyl-6,7,7,7-tetrafluoro-6-(trifluoromethyl)hept-3-en-4-yl]oxy-trimethylsilane (PubChem CID 14914247) has the molecular formula C13H21F7OSi and a molecular weight of 354.38 g/mol. Its IUPAC name is [(E)-5-ethyl-6,7,7,7-tetrafluoro-6-(trifluoromethyl)hept-3-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(E)-5-ethyl-6,7,7,7-tetrafluoro-6-(trifluoromethyl)hept-3-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 14914247 |
| Molecular Formula | C13H21F7OSi |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [(E)-5-ethyl-6,7,7,7-tetrafluoro-6-(trifluoromethyl)hept-3-en-4-yl]oxy-trimethylsilane |
| SMILES | CC/C=C(/O[Si](C)(C)C)C(CC)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H21F7OSi/c1-6-8-10(21-22(3,4)5)9(7-2)11(14,12(15,16)17)13(18,19)20/h8-9H,6-7H2,1-5H3/b10-8+ |
| InChIKey | IAQWIFXBBBZAPL-CSKARUKUSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|