About 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine
1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 1491483) has the molecular formula C13H8Cl2N2O2S
and a molecular weight of 327.19 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine |
| PubChem CID | 1491483 |
| Molecular Formula | C13H8Cl2N2O2S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1Cl)n1ccc2cccnc21 |
| InChI | InChI=1S/C13H8Cl2N2O2S/c14-10-3-4-12(11(15)8-10)20(18,19)17-7-5-9-2-1-6-16-13(9)17/h1-8H |
| InChIKey | NRUAXCBWOVICTL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine?
The IUPAC name of 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine (CID 1491483) is 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine?
The canonical SMILES for 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine is O=S(=O)(c1ccc(Cl)cc1Cl)n1ccc2cccnc21.
What is the InChIKey of 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine?
The InChIKey is NRUAXCBWOVICTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N2O2S/c14-10-3-4-12(11(15)8-10)20(18,19)17-7-5-9-2-1-6-16-13(9)17/h1-8H.
What are the key properties of 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine?
1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine has a molecular weight of 327.19 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dichlorophenyl)sulfonylpyrrolo[2,3-b]pyridine is sourced from PubChem (CID 1491483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).