C26H21F3N4O5S — CID 149150086
N'-[5-[2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-enoyl]-2-fluorophenyl]sulfonyl-2-hydroxy-2-methylpropanimidamide (PubChem CID 149150086) has the molecular formula C26H21F3N4O5S and a molecular weight of 558.54 g/mol. Its IUPAC name is N'-[5-[2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-enoyl]-2-fluorophenyl]sulfonyl-2-hydroxy-2-methylpropanimidamide.
| Compound Name | N'-[5-[2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-enoyl]-2-fluorophenyl]sulfonyl-2-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 149150086 |
| Molecular Formula | C26H21F3N4O5S |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N'-[5-[2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-enoyl]-2-fluorophenyl]sulfonyl-2-hydroxy-2-methylpropanimidamide |
| SMILES | CC(C)(O)C(N)=NS(=O)(=O)c1cc(C(=O)C(=C(O)c2cc(F)cc(F)c2)c2nc3ccccc3[nH]2)ccc1F |
| InChI | InChI=1S/C26H21F3N4O5S/c1-26(2,36)25(30)33-39(37,38)20-11-13(7-8-17(20)29)22(34)21(23(35)14-9-15(27)12-16(28)10-14)24-31-18-5-3-4-6-19(18)32-24/h3-12,35-36H,1-2H3,(H2,30,33)(H,31,32) |
| InChIKey | CZPAMJZLGVFXBJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|