C19H36N4O6 — CID 149150800
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]carbamate (PubChem CID 149150800) has the molecular formula C19H36N4O6 and a molecular weight of 416.52 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 149150800 |
| Molecular Formula | C19H36N4O6 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC/N=C(\N)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H36N4O6/c1-17(2,3)27-14(24)22-12-10-11-21-13(20)23(15(25)28-18(4,5)6)16(26)29-19(7,8)9/h10-12H2,1-9H3,(H2,20,21)(H,22,24) |
| InChIKey | XYHUJXWEGHWKDR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|