About 3-chloro-4,5-difluoro-N-oxidoaniline
3-chloro-4,5-difluoro-N-oxidoaniline (PubChem CID 149156219) has the molecular formula C6H3ClF2NO-
and a molecular weight of 178.55 g/mol. Its IUPAC name is 3-chloro-4,5-difluoro-N-oxidoaniline.
Molecular Properties
| Compound Name | 3-chloro-4,5-difluoro-N-oxidoaniline |
| PubChem CID | 149156219 |
| Molecular Formula | C6H3ClF2NO- |
| Molecular Weight | 178.55 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 3-chloro-4,5-difluoro-N-oxidoaniline |
| SMILES | [O-]Nc1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C6H3ClF2NO/c7-4-1-3(10-11)2-5(8)6(4)9/h1-2,10H/q-1 |
| InChIKey | RQDRKNLVVMKXJH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4,5-difluoro-N-oxidoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4,5-difluoro-N-oxidoaniline?
The IUPAC name of 3-chloro-4,5-difluoro-N-oxidoaniline (CID 149156219) is 3-chloro-4,5-difluoro-N-oxidoaniline.
What is the SMILES notation for 3-chloro-4,5-difluoro-N-oxidoaniline?
The canonical SMILES for 3-chloro-4,5-difluoro-N-oxidoaniline is [O-]Nc1cc(F)c(F)c(Cl)c1.
What is the InChIKey of 3-chloro-4,5-difluoro-N-oxidoaniline?
The InChIKey is RQDRKNLVVMKXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClF2NO/c7-4-1-3(10-11)2-5(8)6(4)9/h1-2,10H/q-1.
What are the key properties of 3-chloro-4,5-difluoro-N-oxidoaniline?
3-chloro-4,5-difluoro-N-oxidoaniline has a molecular weight of 178.55 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4,5-difluoro-N-oxidoaniline is sourced from PubChem (CID 149156219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).