2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid

C11H8ClNO2S — CID 1491572

IUPAC2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(Cc2ccc(Cl)cc2)n1
InChIInChI=1S/C11H8ClNO2S/c12-8-3-1-7(2-4-8)5-10-13-9(6-16-10)11(14)15/h1-4,6H,5H2,(H,14,15)
InChIKeyOSEQLEYPYMSQBU-UHFFFAOYSA-N
MW253.71 g/mol
LogP3.09
Rot. Bonds3

About 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid

2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 1491572) has the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid
PubChem CID1491572
Molecular FormulaC11H8ClNO2S
Molecular Weight253.71 g/mol
Exact Mass253.00
IUPAC Name2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(Cc2ccc(Cl)cc2)n1
InChIInChI=1S/C11H8ClNO2S/c12-8-3-1-7(2-4-8)5-10-13-9(6-16-10)11(14)15/h1-4,6H,5H2,(H,14,15)
InChIKeyOSEQLEYPYMSQBU-UHFFFAOYSA-N
XLogP3.09
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.71
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (CID 1491572) is 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(Cc2ccc(Cl)cc2)n1.
What is the InChIKey of 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is OSEQLEYPYMSQBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO2S/c12-8-3-1-7(2-4-8)5-10-13-9(6-16-10)11(14)15/h1-4,6H,5H2,(H,14,15).
What are the key properties of 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 253.71 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 1491572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).