C24H31ClO6 — CID 149158579
(4-butanoyloxy-6-chloro-2,3-diethoxynaphthalen-1-yl) 2,2-dimethylbutanoate (PubChem CID 149158579) has the molecular formula C24H31ClO6 and a molecular weight of 450.96 g/mol. Its IUPAC name is (4-butanoyloxy-6-chloro-2,3-diethoxynaphthalen-1-yl) 2,2-dimethylbutanoate.
| Compound Name | (4-butanoyloxy-6-chloro-2,3-diethoxynaphthalen-1-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 149158579 |
| Molecular Formula | C24H31ClO6 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (4-butanoyloxy-6-chloro-2,3-diethoxynaphthalen-1-yl) 2,2-dimethylbutanoate |
| SMILES | CCCC(=O)Oc1c(OCC)c(OCC)c(OC(=O)C(C)(C)CC)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H31ClO6/c1-7-11-18(26)30-20-17-14-15(25)12-13-16(17)19(31-23(27)24(5,6)8-2)21(28-9-3)22(20)29-10-4/h12-14H,7-11H2,1-6H3 |
| InChIKey | TXPVQJKAQMMRIU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|