C14H28OS — CID 149159070
2-(6-methylnonan-4-yl)-1,3-oxathiane (PubChem CID 149159070) has the molecular formula C14H28OS and a molecular weight of 244.44 g/mol. Its IUPAC name is 2-(6-methylnonan-4-yl)-1,3-oxathiane.
| Compound Name | 2-(6-methylnonan-4-yl)-1,3-oxathiane |
|---|---|
| PubChem CID | 149159070 |
| Molecular Formula | C14H28OS |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-(6-methylnonan-4-yl)-1,3-oxathiane |
| SMILES | CCCC(C)CC(CCC)C1OCCCS1 |
| InChI | InChI=1S/C14H28OS/c1-4-7-12(3)11-13(8-5-2)14-15-9-6-10-16-14/h12-14H,4-11H2,1-3H3 |
| InChIKey | OHEGDQLLWBOCAB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |