About oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide
oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide (PubChem CID 149159633) has the molecular formula C8H12IMoO-
and a molecular weight of 347.03 g/mol. Its IUPAC name is oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide.
Molecular Properties
| Compound Name | oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide |
| PubChem CID | 149159633 |
| Molecular Formula | C8H12IMoO- |
| Molecular Weight | 347.03 g/mol |
| Exact Mass | 348.90 |
| IUPAC Name | oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide |
| SMILES | I.O=[Mo].[CH2-]CCC1C=CC=C1 |
| InChI | InChI=1S/C8H11.HI.Mo.O/c1-2-5-8-6-3-4-7-8;;;/h3-4,6-8H,1-2,5H2;1H;;/q-1;;; |
| InChIKey | PNZSNADCUHHBNU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide?
The IUPAC name of oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide (CID 149159633) is oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide.
What is the SMILES notation for oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide?
The canonical SMILES for oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide is I.O=[Mo].[CH2-]CCC1C=CC=C1.
What is the InChIKey of oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide?
The InChIKey is PNZSNADCUHHBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11.HI.Mo.O/c1-2-5-8-6-3-4-7-8;;;/h3-4,6-8H,1-2,5H2;1H;;/q-1;;;.
What are the key properties of oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide?
oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide has a molecular weight of 347.03 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxomolybdenum;5-propylcyclopenta-1,3-diene;hydroiodide is sourced from PubChem (CID 149159633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).