About (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol
(6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol (PubChem CID 149160605) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol.
Molecular Properties
| Compound Name | (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol |
| PubChem CID | 149160605 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol |
| SMILES | OCc1ccc(-c2ccc3c(c2)CCC2(CCNCC2)O3)nc1 |
| InChI | InChI=1S/C19H22N2O2/c22-13-14-1-3-17(21-12-14)15-2-4-18-16(11-15)5-6-19(23-18)7-9-20-10-8-19/h1-4,11-12,20,22H,5-10,13H2 |
| InChIKey | VABRXVPSZNDOJR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol?
The IUPAC name of (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol (CID 149160605) is (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol.
What is the SMILES notation for (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol?
The canonical SMILES for (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol is OCc1ccc(-c2ccc3c(c2)CCC2(CCNCC2)O3)nc1.
What is the InChIKey of (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol?
The InChIKey is VABRXVPSZNDOJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c22-13-14-1-3-17(21-12-14)15-2-4-18-16(11-15)5-6-19(23-18)7-9-20-10-8-19/h1-4,11-12,20,22H,5-10,13H2.
What are the key properties of (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol?
(6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol has a molecular weight of 310.40 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl-3-pyridinyl)methanol is sourced from PubChem (CID 149160605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).