About N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine
N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine (PubChem CID 149160726) has the molecular formula C22H48N2O3
and a molecular weight of 388.64 g/mol. Its IUPAC name is N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine.
Molecular Properties
| Compound Name | N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine |
| PubChem CID | 149160726 |
| Molecular Formula | C22H48N2O3 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.37 |
| IUPAC Name | N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine |
| SMILES | CCCCCCCCC(CC(C)NCCCCCCN)C(OC)(OC)OC |
| InChI | InChI=1S/C22H48N2O3/c1-6-7-8-9-10-13-16-21(22(25-3,26-4)27-5)19-20(2)24-18-15-12-11-14-17-23/h20-21,24H,6-19,23H2,1-5H3 |
| InChIKey | VACJNOSZWITXPP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine?
The IUPAC name of N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine (CID 149160726) is N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine.
What is the SMILES notation for N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine?
The canonical SMILES for N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine is CCCCCCCCC(CC(C)NCCCCCCN)C(OC)(OC)OC.
What is the InChIKey of N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine?
The InChIKey is VACJNOSZWITXPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48N2O3/c1-6-7-8-9-10-13-16-21(22(25-3,26-4)27-5)19-20(2)24-18-15-12-11-14-17-23/h20-21,24H,6-19,23H2,1-5H3.
What are the key properties of N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine?
N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine has a molecular weight of 388.64 g/mol, XLogP of 4.83, 20 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(trimethoxymethyl)dodecan-2-yl]hexane-1,6-diamine is sourced from PubChem (CID 149160726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).