C11H22N6 — CID 149162525
4-(3-piperazin-1-ylpropyl)-1H-pyrimidine-2,4-diamine (PubChem CID 149162525) has the molecular formula C11H22N6 and a molecular weight of 238.34 g/mol. Its IUPAC name is 4-(3-piperazin-1-ylpropyl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(3-piperazin-1-ylpropyl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 149162525 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 4-(3-piperazin-1-ylpropyl)-1H-pyrimidine-2,4-diamine |
| SMILES | NC1=NC(N)(CCCN2CCNCC2)C=CN1 |
| InChI | InChI=1S/C11H22N6/c12-10-15-4-3-11(13,16-10)2-1-7-17-8-5-14-6-9-17/h3-4,14H,1-2,5-9,13H2,(H3,12,15,16) |
| InChIKey | FLNYQKZVIUGZLE-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |