About ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate
ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate (PubChem CID 149163232) has the molecular formula C18H13Cl2FN2O5
and a molecular weight of 427.22 g/mol. Its IUPAC name is ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate |
| PubChem CID | 149163232 |
| Molecular Formula | C18H13Cl2FN2O5 |
| Molecular Weight | 427.22 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccccc1)=C(O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C18H13Cl2FN2O5/c1-2-28-18(25)12(9-22-10-6-4-3-5-7-10)17(24)11-8-13(21)15(20)16(14(11)19)23(26)27/h3-9,24H,2H2,1H3/b17-12?,22-9+ |
| InChIKey | GXKZSIFELAOXQL-YZRBXMLFSA-N |
| XLogP | 5.28 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.22 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate?
The IUPAC name of ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate (CID 149163232) is ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate.
What is the SMILES notation for ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate?
The canonical SMILES for ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate is CCOC(=O)C(/C=N/c1ccccc1)=C(O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl.
What is the InChIKey of ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate?
The InChIKey is GXKZSIFELAOXQL-YZRBXMLFSA-N. The full InChI is InChI=1S/C18H13Cl2FN2O5/c1-2-28-18(25)12(9-22-10-6-4-3-5-7-10)17(24)11-8-13(21)15(20)16(14(11)19)23(26)27/h3-9,24H,2H2,1H3/b17-12?,22-9+.
What are the key properties of ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate?
ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate has a molecular weight of 427.22 g/mol, XLogP of 5.28, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxy-2-(phenyliminomethyl)prop-2-enoate is sourced from PubChem (CID 149163232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).