C19H14F5NO3 — CID 149163272
ethyl 2-(2,4-difluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate (PubChem CID 149163272) has the molecular formula C19H14F5NO3 and a molecular weight of 399.32 g/mol. Its IUPAC name is ethyl 2-(2,4-difluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate.
| Compound Name | ethyl 2-(2,4-difluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 149163272 |
| Molecular Formula | C19H14F5NO3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | ethyl 2-(2,4-difluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate |
| SMILES | [H]/N=C(/C(C(=O)OCC)=C(O)c1c(F)cc(F)c(F)c1C)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H14F5NO3/c1-3-28-19(27)15(17(25)10-5-4-9(20)6-11(10)21)18(26)14-8(2)16(24)13(23)7-12(14)22/h4-7,25-26H,3H2,1-2H3/b18-15?,25-17+ |
| InChIKey | DAAJPYLYAYWCEN-HCTSYWEESA-N |
| XLogP | 4.59 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|