C31H24F6N4O2 — CID 149165665
5-[2-[(2R)-5-[9-(difluoromethyl)-5-fluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 149165665) has the molecular formula C31H24F6N4O2 and a molecular weight of 598.55 g/mol. Its IUPAC name is 5-[2-[(2R)-5-[9-(difluoromethyl)-5-fluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-5-[9-(difluoromethyl)-5-fluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 149165665 |
| Molecular Formula | C31H24F6N4O2 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 5-[2-[(2R)-5-[9-(difluoromethyl)-5-fluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)F)c3c2C(F)C2CC32)Cc2cc(F)cc(F)c2)ccc1F |
| InChI | InChI=1S/C31H24F6N4O2/c32-17-7-14(8-18(33)11-17)6-16(27-20(2-1-5-39-27)15-3-4-24(34)23(10-15)31(38)43)9-19(42)13-41-29-25(28(40-41)30(36)37)21-12-22(21)26(29)35/h1-5,7-8,10-11,16,21-22,26,30H,6,9,12-13H2,(H2,38,43)/t16-,21?,22?,26?/m1/s1 |
| InChIKey | WYBDJMZGLRDXPA-YGOCTOHKSA-N |
| XLogP | 6.51 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |