About 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one
2-methyl-4H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 14916649) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 14916649 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | Cc1nc2cccnc2[nH]c1=O |
| InChI | InChI=1S/C8H7N3O/c1-5-8(12)11-7-6(10-5)3-2-4-9-7/h2-4H,1H3,(H,9,11,12) |
| InChIKey | FQYPXESCIKDICR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one (CID 14916649) is 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one is Cc1nc2cccnc2[nH]c1=O.
What is the InChIKey of 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one?
The InChIKey is FQYPXESCIKDICR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c1-5-8(12)11-7-6(10-5)3-2-4-9-7/h2-4H,1H3,(H,9,11,12).
What are the key properties of 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one?
2-methyl-4H-pyrido[2,3-b]pyrazin-3-one has a molecular weight of 161.16 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4H-pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 14916649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).