About 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline
4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline (PubChem CID 149166937) has the molecular formula C10H9F3N2
and a molecular weight of 214.19 g/mol. Its IUPAC name is 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline.
Molecular Properties
| Compound Name | 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline |
| PubChem CID | 149166937 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline |
| SMILES | CC1=C2C=C(C(F)(F)F)C=CC2N=CN1 |
| InChI | InChI=1S/C10H9F3N2/c1-6-8-4-7(10(11,12)13)2-3-9(8)15-5-14-6/h2-5,9H,1H3,(H,14,15) |
| InChIKey | WYHKTVAKZGCCFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline?
The IUPAC name of 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline (CID 149166937) is 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline.
What is the SMILES notation for 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline?
The canonical SMILES for 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline is CC1=C2C=C(C(F)(F)F)C=CC2N=CN1.
What is the InChIKey of 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline?
The InChIKey is WYHKTVAKZGCCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2/c1-6-8-4-7(10(11,12)13)2-3-9(8)15-5-14-6/h2-5,9H,1H3,(H,14,15).
What are the key properties of 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline?
4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline has a molecular weight of 214.19 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-(trifluoromethyl)-3,8a-dihydroquinazoline is sourced from PubChem (CID 149166937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).