About (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate
(5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate (PubChem CID 149171191) has the molecular formula C9H15N5O3
and a molecular weight of 241.25 g/mol. Its IUPAC name is (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate.
Molecular Properties
| Compound Name | (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate |
| PubChem CID | 149171191 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate |
| SMILES | NCC1=CNNN1C(=O)OC1CCC(C=O)N1 |
| InChI | InChI=1S/C9H15N5O3/c10-3-7-4-11-13-14(7)9(16)17-8-2-1-6(5-15)12-8/h4-6,8,11-13H,1-3,10H2 |
| InChIKey | WZCASSFTABUJMD-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate?
The IUPAC name of (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate (CID 149171191) is (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate.
What is the SMILES notation for (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate?
The canonical SMILES for (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate is NCC1=CNNN1C(=O)OC1CCC(C=O)N1.
What is the InChIKey of (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate?
The InChIKey is WZCASSFTABUJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O3/c10-3-7-4-11-13-14(7)9(16)17-8-2-1-6(5-15)12-8/h4-6,8,11-13H,1-3,10H2.
What are the key properties of (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate?
(5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate has a molecular weight of 241.25 g/mol, XLogP of -1.48, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-formylpyrrolidin-2-yl) 4-(aminomethyl)-1,2-dihydrotriazole-3-carboxylate is sourced from PubChem (CID 149171191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).