About 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate
9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 149172489) has the molecular formula C22H30O3
and a molecular weight of 342.48 g/mol. Its IUPAC name is 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
Molecular Properties
| Compound Name | 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| PubChem CID | 149172489 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OC1C2CCCC1CCC2)[C@](O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C22H30O3/c23-21(25-20-16-8-6-9-17(20)11-7-10-16)22(24,19-14-4-5-15-19)18-12-2-1-3-13-18/h1-3,12-13,16-17,19-20,24H,4-11,14-15H2/t16?,17?,20?,22-/m0/s1 |
| InChIKey | WZIHXMLPOPHJBT-DJBOQGILSA-N |
| XLogP | 4.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate?
The IUPAC name of 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (CID 149172489) is 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
What is the SMILES notation for 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate?
The canonical SMILES for 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate is O=C(OC1C2CCCC1CCC2)[C@](O)(c1ccccc1)C1CCCC1.
What is the InChIKey of 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate?
The InChIKey is WZIHXMLPOPHJBT-DJBOQGILSA-N. The full InChI is InChI=1S/C22H30O3/c23-21(25-20-16-8-6-9-17(20)11-7-10-16)22(24,19-14-4-5-15-19)18-12-2-1-3-13-18/h1-3,12-13,16-17,19-20,24H,4-11,14-15H2/t16?,17?,20?,22-/m0/s1.
What are the key properties of 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate?
9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate has a molecular weight of 342.48 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bicyclo[3.3.1]nonanyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate is sourced from PubChem (CID 149172489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).