C27H39NO5 — CID 149179925
2-(aminomethoxy)-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-9,13-dimethyl-16-methylidene-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]ethanone (PubChem CID 149179925) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is 2-(aminomethoxy)-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-9,13-dimethyl-16-methylidene-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]ethanone.
| Compound Name | 2-(aminomethoxy)-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-9,13-dimethyl-16-methylidene-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]ethanone |
|---|---|
| PubChem CID | 149179925 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 2-(aminomethoxy)-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-9,13-dimethyl-16-methylidene-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]ethanone |
| SMILES | C=C1C=C[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@H]1OC(CCC)O[C@]12C(=O)COCN |
| InChI | InChI=1S/C27H39NO5/c1-5-6-23-32-22-12-19-18-8-7-17-11-16(2)9-10-25(17,3)24(18)20(29)13-26(19,4)27(22,33-23)21(30)14-31-15-28/h9-11,18-20,22-24,29H,2,5-8,12-15,28H2,1,3-4H3/t18-,19-,20-,22+,23?,24+,25-,26-,27+/m0/s1 |
| InChIKey | XATBDJVCNGRLHG-PONRWWDOSA-N |
| XLogP | 3.64 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|