About 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine
5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine (PubChem CID 1491809) has the molecular formula C6H7N5S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine |
| PubChem CID | 1491809 |
| Molecular Formula | C6H7N5S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine |
| SMILES | CSc1nc(N)cc2ncnn12 |
| InChI | InChI=1S/C6H7N5S/c1-12-6-10-4(7)2-5-8-3-9-11(5)6/h2-3H,7H2,1H3 |
| InChIKey | LQWFBJQUUPZEDY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine?
The IUPAC name of 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine (CID 1491809) is 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine.
What is the SMILES notation for 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine?
The canonical SMILES for 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine is CSc1nc(N)cc2ncnn12.
What is the InChIKey of 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine?
The InChIKey is LQWFBJQUUPZEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5S/c1-12-6-10-4(7)2-5-8-3-9-11(5)6/h2-3H,7H2,1H3.
What are the key properties of 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine?
5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine has a molecular weight of 181.22 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-amine is sourced from PubChem (CID 1491809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).