C62H36F2N8 — CID 149181702
2-(4-fluorophenyl)-9-[3-[9-(4-fluorophenyl)-4,7-dipyridin-3-yl-1,10-phenanthrolin-2-yl]phenyl]-4,7-dipyridin-3-yl-1,10-phenanthroline (PubChem CID 149181702) has the molecular formula C62H36F2N8 and a molecular weight of 931.02 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-9-[3-[9-(4-fluorophenyl)-4,7-dipyridin-3-yl-1,10-phenanthrolin-2-yl]phenyl]-4,7-dipyridin-3-yl-1,10-phenanthroline.
| Compound Name | 2-(4-fluorophenyl)-9-[3-[9-(4-fluorophenyl)-4,7-dipyridin-3-yl-1,10-phenanthrolin-2-yl]phenyl]-4,7-dipyridin-3-yl-1,10-phenanthroline |
|---|---|
| PubChem CID | 149181702 |
| Molecular Formula | C62H36F2N8 |
| Molecular Weight | 931.02 g/mol |
| Exact Mass | 930.30 |
| IUPAC Name | 2-(4-fluorophenyl)-9-[3-[9-(4-fluorophenyl)-4,7-dipyridin-3-yl-1,10-phenanthrolin-2-yl]phenyl]-4,7-dipyridin-3-yl-1,10-phenanthroline |
| SMILES | Fc1ccc(-c2cc(-c3cccnc3)c3ccc4c(-c5cccnc5)cc(-c5cccc(-c6cc(-c7cccnc7)c7ccc8c(-c9cccnc9)cc(-c9ccc(F)cc9)nc8c7n6)c5)nc4c3n2)cc1 |
| InChI | InChI=1S/C62H36F2N8/c63-45-16-12-37(13-17-45)55-29-51(41-8-2-24-65-33-41)47-20-22-49-53(43-10-4-26-67-35-43)31-57(71-61(49)59(47)69-55)39-6-1-7-40(28-39)58-32-54(44-11-5-27-68-36-44)50-23-21-48-52(42-9-3-25-66-34-42)30-56(70-60(48)62(50)72-58)38-14-18-46(64)19-15-38/h1-36H |
| InChIKey | XBBZCRIAQDLPNA-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.02 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|