C13H11N5OS — CID 1491832
8-amino-3-methyl-2-phenoxypyrimido[1,6-b][1,2,4]triazine-6-thione (PubChem CID 1491832) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 8-amino-3-methyl-2-phenoxypyrimido[1,6-b][1,2,4]triazine-6-thione.
| Compound Name | 8-amino-3-methyl-2-phenoxypyrimido[1,6-b][1,2,4]triazine-6-thione |
|---|---|
| PubChem CID | 1491832 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 8-amino-3-methyl-2-phenoxypyrimido[1,6-b][1,2,4]triazine-6-thione |
| SMILES | Cc1nn2c(=S)nc(N)cc2nc1Oc1ccccc1 |
| InChI | InChI=1S/C13H11N5OS/c1-8-12(19-9-5-3-2-4-6-9)16-11-7-10(14)15-13(20)18(11)17-8/h2-7H,1H3,(H2,14,15,20) |
| InChIKey | PSEYYIBIWGRIJY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|