About N,2,5-trimethylaniline
N,2,5-trimethylaniline (PubChem CID 14918440) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is N,2,5-trimethylaniline.
Molecular Properties
| Compound Name | N,2,5-trimethylaniline |
| PubChem CID | 14918440 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N,2,5-trimethylaniline |
| SMILES | CNc1cc(C)ccc1C |
| InChI | InChI=1S/C9H13N/c1-7-4-5-8(2)9(6-7)10-3/h4-6,10H,1-3H3 |
| InChIKey | FLLXIDNFXBLBMT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,2,5-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2,5-trimethylaniline?
The IUPAC name of N,2,5-trimethylaniline (CID 14918440) is N,2,5-trimethylaniline.
What is the SMILES notation for N,2,5-trimethylaniline?
The canonical SMILES for N,2,5-trimethylaniline is CNc1cc(C)ccc1C.
What is the InChIKey of N,2,5-trimethylaniline?
The InChIKey is FLLXIDNFXBLBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-7-4-5-8(2)9(6-7)10-3/h4-6,10H,1-3H3.
What are the key properties of N,2,5-trimethylaniline?
N,2,5-trimethylaniline has a molecular weight of 135.21 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2,5-trimethylaniline is sourced from PubChem (CID 14918440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).