About 3-methoxy-N,2-dimethylaniline
3-methoxy-N,2-dimethylaniline (PubChem CID 14918451) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methoxy-N,2-dimethylaniline.
Molecular Properties
| Compound Name | 3-methoxy-N,2-dimethylaniline |
| PubChem CID | 14918451 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-methoxy-N,2-dimethylaniline |
| SMILES | CNc1cccc(OC)c1C |
| InChI | InChI=1S/C9H13NO/c1-7-8(10-2)5-4-6-9(7)11-3/h4-6,10H,1-3H3 |
| InChIKey | CQZYVBMGQFYAGU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,2-dimethylaniline?
The IUPAC name of 3-methoxy-N,2-dimethylaniline (CID 14918451) is 3-methoxy-N,2-dimethylaniline.
What is the SMILES notation for 3-methoxy-N,2-dimethylaniline?
The canonical SMILES for 3-methoxy-N,2-dimethylaniline is CNc1cccc(OC)c1C.
What is the InChIKey of 3-methoxy-N,2-dimethylaniline?
The InChIKey is CQZYVBMGQFYAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-8(10-2)5-4-6-9(7)11-3/h4-6,10H,1-3H3.
What are the key properties of 3-methoxy-N,2-dimethylaniline?
3-methoxy-N,2-dimethylaniline has a molecular weight of 151.21 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,2-dimethylaniline is sourced from PubChem (CID 14918451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).