C8H12N2O — CID 149185446
3-methyl-3a,4,5,7a-tetrahydro-1H-benzimidazol-2-one (PubChem CID 149185446) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-methyl-3a,4,5,7a-tetrahydro-1H-benzimidazol-2-one.
| Compound Name | 3-methyl-3a,4,5,7a-tetrahydro-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 149185446 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-methyl-3a,4,5,7a-tetrahydro-1H-benzimidazol-2-one |
| SMILES | CN1C(=O)NC2C=CCCC21 |
| InChI | InChI=1S/C8H12N2O/c1-10-7-5-3-2-4-6(7)9-8(10)11/h2,4,6-7H,3,5H2,1H3,(H,9,11) |
| InChIKey | XBTZUTVOCBJVKB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|