C20H23N7O2 — CID 149193231
N-[(6R)-2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-5-[(4-methylphenyl)methyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 149193231) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[(6R)-2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-5-[(4-methylphenyl)methyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(6R)-2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-5-[(4-methylphenyl)methyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 149193231 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[(6R)-2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-5-[(4-methylphenyl)methyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(Cc2nc(C(=O)N[C@@H]3CCn4nc(C)cc4N(C)C3=O)n[nH]2)cc1 |
| InChI | InChI=1S/C20H23N7O2/c1-12-4-6-14(7-5-12)11-16-22-18(24-23-16)19(28)21-15-8-9-27-17(10-13(2)25-27)26(3)20(15)29/h4-7,10,15H,8-9,11H2,1-3H3,(H,21,28)(H,22,23,24)/t15-/m1/s1 |
| InChIKey | XDFYYQQPDYAKHG-OAHLLOKOSA-N |
| XLogP | 1.37 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |