C22H18F3NO5 — CID 149193663
11-(2-hydroxyethyl)-17-[3-(trifluoromethyl)phenyl]-4,7,14-trioxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,12(16)-tetraen-15-one (PubChem CID 149193663) has the molecular formula C22H18F3NO5 and a molecular weight of 433.38 g/mol. Its IUPAC name is 11-(2-hydroxyethyl)-17-[3-(trifluoromethyl)phenyl]-4,7,14-trioxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,12(16)-tetraen-15-one.
| Compound Name | 11-(2-hydroxyethyl)-17-[3-(trifluoromethyl)phenyl]-4,7,14-trioxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,12(16)-tetraen-15-one |
|---|---|
| PubChem CID | 149193663 |
| Molecular Formula | C22H18F3NO5 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 11-(2-hydroxyethyl)-17-[3-(trifluoromethyl)phenyl]-4,7,14-trioxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,12(16)-tetraen-15-one |
| SMILES | O=C1OCC2=C1C(c1cccc(C(F)(F)F)c1)c1cc3c(cc1N2CCO)OCCO3 |
| InChI | InChI=1S/C22H18F3NO5/c23-22(24,25)13-3-1-2-12(8-13)19-14-9-17-18(30-7-6-29-17)10-15(14)26(4-5-27)16-11-31-21(28)20(16)19/h1-3,8-10,19,27H,4-7,11H2 |
| InChIKey | XDICVMRXOSSBRR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |