About 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one
5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one (PubChem CID 149195244) has the molecular formula C19H17F2N3O
and a molecular weight of 341.36 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one.
Molecular Properties
| Compound Name | 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one |
| PubChem CID | 149195244 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one |
| SMILES | CC(F)(F)C1(C)CC(=O)N(c2ccc(C#Cc3ccccc3)cn2)N1 |
| InChI | InChI=1S/C19H17F2N3O/c1-18(19(2,20)21)12-17(25)24(23-18)16-11-10-15(13-22-16)9-8-14-6-4-3-5-7-14/h3-7,10-11,13,23H,12H2,1-2H3 |
| InChIKey | XDPTXHRRGZVTGG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one?
The IUPAC name of 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one (CID 149195244) is 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one.
What is the SMILES notation for 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one?
The canonical SMILES for 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one is CC(F)(F)C1(C)CC(=O)N(c2ccc(C#Cc3ccccc3)cn2)N1.
What is the InChIKey of 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one?
The InChIKey is XDPTXHRRGZVTGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O/c1-18(19(2,20)21)12-17(25)24(23-18)16-11-10-15(13-22-16)9-8-14-6-4-3-5-7-14/h3-7,10-11,13,23H,12H2,1-2H3.
What are the key properties of 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one?
5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one has a molecular weight of 341.36 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoroethyl)-5-methyl-2-[5-(2-phenylethynyl)-2-pyridinyl]pyrazolidin-3-one is sourced from PubChem (CID 149195244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).