C37H30BNO3 — CID 149196459
2-phenyl-14-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-oxa-15-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene (PubChem CID 149196459) has the molecular formula C37H30BNO3 and a molecular weight of 547.46 g/mol. Its IUPAC name is 2-phenyl-14-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-oxa-15-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene.
| Compound Name | 2-phenyl-14-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-oxa-15-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 149196459 |
| Molecular Formula | C37H30BNO3 |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 2-phenyl-14-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-oxa-15-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
| SMILES | CC1(C)OB(c2ccc(-c3nc4ccccc4c4c(-c5ccccc5)c5c(cc34)oc3ccccc35)cc2)OC1(C)C |
| InChI | InChI=1S/C37H30BNO3/c1-36(2)37(3,4)42-38(41-36)25-20-18-24(19-21-25)35-28-22-31-34(27-15-9-11-17-30(27)40-31)32(23-12-6-5-7-13-23)33(28)26-14-8-10-16-29(26)39-35/h5-22H,1-4H3 |
| InChIKey | XDVVGGLUDGGCSF-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|