C15H16N2O3 — CID 149198292
methyl 4-(benzylamino)-6-methoxypyridine-3-carboxylate (PubChem CID 149198292) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 4-(benzylamino)-6-methoxypyridine-3-carboxylate.
| Compound Name | methyl 4-(benzylamino)-6-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 149198292 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | methyl 4-(benzylamino)-6-methoxypyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(OC)cc1NCc1ccccc1 |
| InChI | InChI=1S/C15H16N2O3/c1-19-14-8-13(12(10-17-14)15(18)20-2)16-9-11-6-4-3-5-7-11/h3-8,10H,9H2,1-2H3,(H,16,17) |
| InChIKey | XEENPTNDAXIAMV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |