C12H24OSi — CID 14919962
tert-butyl-hexa-4,5-dienoxy-dimethylsilane (PubChem CID 14919962) has the molecular formula C12H24OSi and a molecular weight of 212.41 g/mol. Its IUPAC name is tert-butyl-hexa-4,5-dienoxy-dimethylsilane.
| Compound Name | tert-butyl-hexa-4,5-dienoxy-dimethylsilane |
|---|---|
| PubChem CID | 14919962 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | tert-butyl-hexa-4,5-dienoxy-dimethylsilane |
| SMILES | C=C=CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-7-8-9-10-11-13-14(5,6)12(2,3)4/h8H,1,9-11H2,2-6H3 |
| InChIKey | MZIHSAIWIPJNRI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|