C15H16F3NO2 — CID 149201025
1-[4-(1-amino-4,4,4-trifluoro-3-oxobut-1-enyl)phenyl]-2,2-dimethylpropan-1-one (PubChem CID 149201025) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 1-[4-(1-amino-4,4,4-trifluoro-3-oxobut-1-enyl)phenyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(1-amino-4,4,4-trifluoro-3-oxobut-1-enyl)phenyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 149201025 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-[4-(1-amino-4,4,4-trifluoro-3-oxobut-1-enyl)phenyl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1ccc(C(N)=CC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO2/c1-14(2,3)13(21)10-6-4-9(5-7-10)11(19)8-12(20)15(16,17)18/h4-8H,19H2,1-3H3 |
| InChIKey | QLHLMIHHBPZWRL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|