About 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile
1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile (PubChem CID 149201129) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile |
| PubChem CID | 149201129 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile |
| SMILES | N#CC1(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C10H11N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h2,4-5H,1,3,6-7H2 |
| InChIKey | XESFCOKJIVUNQM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile?
The IUPAC name of 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile (CID 149201129) is 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile is N#CC1(C2=CCCC=C2)CC1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile?
The InChIKey is XESFCOKJIVUNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h2,4-5H,1,3,6-7H2.
What are the key properties of 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile?
1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile has a molecular weight of 145.20 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-ylcyclopropane-1-carbonitrile is sourced from PubChem (CID 149201129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).