C19H28ClN4O8P — CID 149202711
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid (PubChem CID 149202711) has the molecular formula C19H28ClN4O8P and a molecular weight of 506.88 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 149202711 |
| Molecular Formula | C19H28ClN4O8P |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid |
| SMILES | CC(CO)(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C19H28ClN4O8P/c1-19(9-25,33(28,29)30)31-8-13-15(26)16(27)18(32-13)24-17-11(7-21-24)12(6-14(20)23-17)22-10-4-2-3-5-10/h6-7,10,13,15-16,18,25-27H,2-5,8-9H2,1H3,(H,22,23)(H2,28,29,30)/t13-,15-,16-,18-,19?/m1/s1 |
| InChIKey | XEZWHJFCKCRPEO-GPFBTPOHSA-N |
| XLogP | 0.96 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|